Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
| Molecular Weight (g/mol) | 189.71 |
|---|---|
| Color | Orange |
| Physical Form | Liquid |
| Chemical Name or Material | Titanium(IV) chloride |
| SMILES | [Cl-].[Cl-].[Cl-].[Cl-].[Ti+4] |
| Merck Index | 15, 9634 |
| InChI Key | XJDNKRIXUMDJCW-UHFFFAOYSA-J |
| Density | 0.9640g/mL |
| PubChem CID | 160960 |
| Name Note | 1M Solution in Toluene |
| Concentration or Composition (by Analyte or Components) | 0.95 to 1.1M |
| CAS | 108-88-3 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. IF IN EYES: Rinse cautiously with water for seve |
| MDL Number | MFCD00011267 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. Toxic if inhaled. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of damaging the unborn child. May cause drowsiness or dizziness |
| Solubility Information | Solubility in water: reacts |
| Flash Point | 8°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | titanium iv chloride,titanium 4+ tetrachloride,acmc-1bjgv,titanium 4+ ion tetrachloride,parent,titanium +4 cation tetrachloride,titanium iv chloride 100ml,superlist names titanium chloride, t-4,titanic chloride; titanio tetracloruro di,unii-8o3pje5t7q; titanium chloride ticl4 |
| IUPAC Name | titanium(4+);tetrachloride |
| Molecular Formula | Cl4Ti |
| EINECS Number | 231-441-9 |
| Formula Weight | 189.71 |
| Specific Gravity | 0.964 |
Ammonium Acetate Anhydrous, ACS Reagent Grade, MP Biomedicals™
CAS: 631-61-8 Molecular Formula: C2H7NO2 Molecular Weight (g/mol): 77.083 InChI Key: USFZMSVCRYTOJT-UHFFFAOYSA-N Synonym: ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 PubChem CID: 517165 ChEBI: CHEBI:62947 IUPAC Name: azanium;acetate SMILES: CC(=O)[O-].[NH4+]
| PubChem CID | 517165 |
|---|---|
| CAS | 631-61-8 |
| Molecular Weight (g/mol) | 77.083 |
| ChEBI | CHEBI:62947 |
| SMILES | CC(=O)[O-].[NH4+] |
| Synonym | ammonium acetate,acetic acid, ammonium salt,azanium acetate,ammoniumacetate,acetic acid ammonium salt,ammonium ethanoate,unii-rre756s6q2,aconh4,ch3coonh4,ch3co2nh4 |
| IUPAC Name | azanium;acetate |
| InChI Key | USFZMSVCRYTOJT-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO2 |
Thermo Scientific Chemicals Lithium dodecylsulfate, 98%
CAS: 2044-56-6 Molecular Formula: C12H25LiO4S Molecular Weight (g/mol): 272.33 MDL Number: MFCD00007467 InChI Key: YFVGRULMIQXYNE-UHFFFAOYSA-M Synonym: lithium dodecyl sulfate,lithium dodecylsulfate,sulfuric acid, monododecyl ester, lithium salt,lauryl sulfate lithium salt,lithium lauryl sulfate,dodecyl lithium sulfate,lds,lithium 1+ ion dodecyl sulfate,sulfuric acid, monododecyl ester, lithium salt 1:1,lithium dodecyl sulfate, ultra pure PubChem CID: 2735071 SMILES: [Li+].CCCCCCCCCCCCOS([O-])(=O)=O
| PubChem CID | 2735071 |
|---|---|
| CAS | 2044-56-6 |
| Molecular Weight (g/mol) | 272.33 |
| MDL Number | MFCD00007467 |
| SMILES | [Li+].CCCCCCCCCCCCOS([O-])(=O)=O |
| Synonym | lithium dodecyl sulfate,lithium dodecylsulfate,sulfuric acid, monododecyl ester, lithium salt,lauryl sulfate lithium salt,lithium lauryl sulfate,dodecyl lithium sulfate,lds,lithium 1+ ion dodecyl sulfate,sulfuric acid, monododecyl ester, lithium salt 1:1,lithium dodecyl sulfate, ultra pure |
| InChI Key | YFVGRULMIQXYNE-UHFFFAOYSA-M |
| Molecular Formula | C12H25LiO4S |
Zinc(II) acetylacetonate, ca. 25% Zn
CAS: 14024-63-6 Molecular Formula: C10H14O4Zn Molecular Weight (g/mol): 263.60 MDL Number: MFCD00000035 InChI Key: CYDXJXDAFPJUQE-FDGPNNRMSA-L Synonym: zinc acetylacetonate hydrate,zinc 2,4-pentanedionate, hydrate,zinc 2+ bis 2z-4-oxopent-2-en-2-olate hydrate PubChem CID: 131675103 SMILES: [Zn++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| PubChem CID | 131675103 |
|---|---|
| CAS | 14024-63-6 |
| Molecular Weight (g/mol) | 263.60 |
| MDL Number | MFCD00000035 |
| SMILES | [Zn++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | zinc acetylacetonate hydrate,zinc 2,4-pentanedionate, hydrate,zinc 2+ bis 2z-4-oxopent-2-en-2-olate hydrate |
| InChI Key | CYDXJXDAFPJUQE-FDGPNNRMSA-L |
| Molecular Formula | C10H14O4Zn |
1-Phenyl-3-trimethylsilyl-2-propyn-1-ol, 97%
CAS: 89530-34-7 Molecular Formula: C12H16OSi Molecular Weight (g/mol): 204.344 MDL Number: MFCD05864336 InChI Key: RVTDALNDYLDVMN-UHFFFAOYSA-N Synonym: 1-phenyl-3-trimethylsilyl-2-propyn-1-ol,1-phenyl-3-trimethylsilyl prop-2-yn-1-ol,benzenemethanol, a-2-trimethylsilyl ethynyl,acmc-20ln8h,alpha-trimethylsilyl ethynylbenzyl alcohol,4,4-dimethyl-1-phenyl-4-silapent-2-yn-1-ol,alpha-trimethylsilyl ethynyl-benzenemethanol,alpha-trimethylsilyl-ethynyl-benzenemethanol,alpha-trimethylsilyl ethynyl-benzene-methanol,1-phenyl-3-1,1,1-trimethylsilyl-2-propyn-1-ol PubChem CID: 2760416 IUPAC Name: 1-phenyl-3-trimethylsilylprop-2-yn-1-ol SMILES: C[Si](C)(C)C#CC(C1=CC=CC=C1)O
| PubChem CID | 2760416 |
|---|---|
| CAS | 89530-34-7 |
| Molecular Weight (g/mol) | 204.344 |
| MDL Number | MFCD05864336 |
| SMILES | C[Si](C)(C)C#CC(C1=CC=CC=C1)O |
| Synonym | 1-phenyl-3-trimethylsilyl-2-propyn-1-ol,1-phenyl-3-trimethylsilyl prop-2-yn-1-ol,benzenemethanol, a-2-trimethylsilyl ethynyl,acmc-20ln8h,alpha-trimethylsilyl ethynylbenzyl alcohol,4,4-dimethyl-1-phenyl-4-silapent-2-yn-1-ol,alpha-trimethylsilyl ethynyl-benzenemethanol,alpha-trimethylsilyl-ethynyl-benzenemethanol,alpha-trimethylsilyl ethynyl-benzene-methanol,1-phenyl-3-1,1,1-trimethylsilyl-2-propyn-1-ol |
| IUPAC Name | 1-phenyl-3-trimethylsilylprop-2-yn-1-ol |
| InChI Key | RVTDALNDYLDVMN-UHFFFAOYSA-N |
| Molecular Formula | C12H16OSi |
Ammonium sulfate, 99%, pure
CAS: 7783-20-2 Molecular Formula: H8N2O4S Molecular Weight (g/mol): 132.13 MDL Number: MFCD00003391 InChI Key: BFNBIHQBYMNNAN-UHFFFAOYSA-N Synonym: ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate PubChem CID: 6097028 ChEBI: CHEBI:62946 SMILES: N.N.OS(O)(=O)=O
| PubChem CID | 6097028 |
|---|---|
| CAS | 7783-20-2 |
| Molecular Weight (g/mol) | 132.13 |
| ChEBI | CHEBI:62946 |
| MDL Number | MFCD00003391 |
| SMILES | N.N.OS(O)(=O)=O |
| Synonym | ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate |
| InChI Key | BFNBIHQBYMNNAN-UHFFFAOYSA-N |
| Molecular Formula | H8N2O4S |
Silver wire, 2.0mm (0.08in) dia, annealed, 99.9% (metals basis)
CAS: 7440-22-4 Molecular Formula: Ag Molecular Weight (g/mol): 107.87 MDL Number: MFCD00003397 InChI Key: BQCADISMDOOEFD-UHFFFAOYSA-N Synonym: argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber PubChem CID: 23954 ChEBI: CHEBI:9141 IUPAC Name: silver SMILES: [Ag]
| PubChem CID | 23954 |
|---|---|
| CAS | 7440-22-4 |
| Molecular Weight (g/mol) | 107.87 |
| ChEBI | CHEBI:9141 |
| MDL Number | MFCD00003397 |
| SMILES | [Ag] |
| Synonym | argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber |
| IUPAC Name | silver |
| InChI Key | BQCADISMDOOEFD-UHFFFAOYSA-N |
| Molecular Formula | Ag |
Cesium sulfate, 99.9% (metals basis)
CAS: 10294-54-9 Molecular Formula: Cs2O4S Molecular Weight (g/mol): 361.87 MDL Number: MFCD00010959 InChI Key: FLJPGEWQYJVDPF-UHFFFAOYSA-L Synonym: cesium sulfate,dicesium sulfate,sulfuric acid, dicesium salt,caesium sulphate,caesium sulfate,unii-8d6r91cs62,dicaesium 1+ ion sulfate,cesiumsulfate,dicaesium 1+ sulfate PubChem CID: 25137 SMILES: [Cs+].[Cs+].[O-]S([O-])(=O)=O
| PubChem CID | 25137 |
|---|---|
| CAS | 10294-54-9 |
| Molecular Weight (g/mol) | 361.87 |
| MDL Number | MFCD00010959 |
| SMILES | [Cs+].[Cs+].[O-]S([O-])(=O)=O |
| Synonym | cesium sulfate,dicesium sulfate,sulfuric acid, dicesium salt,caesium sulphate,caesium sulfate,unii-8d6r91cs62,dicaesium 1+ ion sulfate,cesiumsulfate,dicaesium 1+ sulfate |
| InChI Key | FLJPGEWQYJVDPF-UHFFFAOYSA-L |
| Molecular Formula | Cs2O4S |
| Packaging | Plastic bottle |
|---|---|
| Physical Form | Liquid |
| Chemical Name or Material | Ringer's Solution |
| Synonym | dihydrogen oxide,dihydrogen monoxide |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
Sand, Standard, MilliporeSigma™
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: silanedione SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | silanedione |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Strontium hydroxide octahydrate, 99% (metals basis)
CAS: 1311-10-0 Molecular Formula: H18O10Sr Molecular Weight (g/mol): 265.75 MDL Number: MFCD00150395 InChI Key: UJPWWRPNIRRCPJ-UHFFFAOYSA-L IUPAC Name: strontium(2+) octahydrate dihydroxide SMILES: O.O.O.O.O.O.O.O.[OH-].[OH-].[Sr++]
| CAS | 1311-10-0 |
|---|---|
| Molecular Weight (g/mol) | 265.75 |
| MDL Number | MFCD00150395 |
| SMILES | O.O.O.O.O.O.O.O.[OH-].[OH-].[Sr++] |
| IUPAC Name | strontium(2+) octahydrate dihydroxide |
| InChI Key | UJPWWRPNIRRCPJ-UHFFFAOYSA-L |
| Molecular Formula | H18O10Sr |
Sodium hexafluorophosphate, 99+%
CAS: 21324-39-0 Molecular Formula: F6NaP Molecular Weight (g/mol): 167.95 MDL Number: MFCD00011122 InChI Key: KMADQUOCJBLXRP-UHFFFAOYSA-N Synonym: sodium hexafluorophosphate,sodium hexa-fluoro phosphate,sodium hexafluorophosphate v,napf6,sodium hexaflurophosphate,acmc-1cao2,sodium hexafluoro-,e5-phosphanuide,sodium hexafluoro-$l^ 5-phosphanuide,phosphate 1-, hexafluoro-, sodium 1:1 PubChem CID: 5147921 IUPAC Name: sodium;hexafluorophosphate SMILES: [Na+].F[P-](F)(F)(F)(F)F
| PubChem CID | 5147921 |
|---|---|
| CAS | 21324-39-0 |
| Molecular Weight (g/mol) | 167.95 |
| MDL Number | MFCD00011122 |
| SMILES | [Na+].F[P-](F)(F)(F)(F)F |
| Synonym | sodium hexafluorophosphate,sodium hexa-fluoro phosphate,sodium hexafluorophosphate v,napf6,sodium hexaflurophosphate,acmc-1cao2,sodium hexafluoro-,e5-phosphanuide,sodium hexafluoro-$l^ 5-phosphanuide,phosphate 1-, hexafluoro-, sodium 1:1 |
| IUPAC Name | sodium;hexafluorophosphate |
| InChI Key | KMADQUOCJBLXRP-UHFFFAOYSA-N |
| Molecular Formula | F6NaP |
Lithium sulfate, 99%, extra pure, anhydrous
CAS: 10377-48-7 Molecular Formula: Li2O4S Molecular Weight (g/mol): 109.94 MDL Number: MFCD00011086 InChI Key: INHCSSUBVCNVSK-UHFFFAOYSA-L Synonym: lithium sulfate,lithium sulphate,dilithium sulfate,sulfuric acid, dilithium salt,lithiophor,li2so4,dilthium sulfate,sulfuric acid, lithium salt 1:2,unii-919xa137jk,lithium sulfate, anhydrous PubChem CID: 66320 ChEBI: CHEBI:53474 SMILES: [Li+].[Li+].[O-]S([O-])(=O)=O
| PubChem CID | 66320 |
|---|---|
| CAS | 10377-48-7 |
| Molecular Weight (g/mol) | 109.94 |
| ChEBI | CHEBI:53474 |
| MDL Number | MFCD00011086 |
| SMILES | [Li+].[Li+].[O-]S([O-])(=O)=O |
| Synonym | lithium sulfate,lithium sulphate,dilithium sulfate,sulfuric acid, dilithium salt,lithiophor,li2so4,dilthium sulfate,sulfuric acid, lithium salt 1:2,unii-919xa137jk,lithium sulfate, anhydrous |
| InChI Key | INHCSSUBVCNVSK-UHFFFAOYSA-L |
| Molecular Formula | Li2O4S |
Ytterbium powder, -40 mesh, 99.9% (REO)
CAS: 7440-64-4 Molecular Formula: Yb Molecular Weight (g/mol): 173.05 MDL Number: MFCD00011286 InChI Key: NAWDYIZEMPQZHO-UHFFFAOYSA-N Synonym: unii-mnq4o4wsi1,hydride,mnq4o4wsi1,foil, 3n,yterbio,ingot,powder,ii ion,chips, 3n,ingot, 3n PubChem CID: 23992 ChEBI: CHEBI:33381 IUPAC Name: ytterbium SMILES: [Yb]
| PubChem CID | 23992 |
|---|---|
| CAS | 7440-64-4 |
| Molecular Weight (g/mol) | 173.05 |
| ChEBI | CHEBI:33381 |
| MDL Number | MFCD00011286 |
| SMILES | [Yb] |
| Synonym | unii-mnq4o4wsi1,hydride,mnq4o4wsi1,foil, 3n,yterbio,ingot,powder,ii ion,chips, 3n,ingot, 3n |
| IUPAC Name | ytterbium |
| InChI Key | NAWDYIZEMPQZHO-UHFFFAOYSA-N |
| Molecular Formula | Yb |
Manganese(II) nitrate hydrate, Puratronic™, 99.995% (metals basis)
CAS: 15710-66-4 Molecular Formula: MnN2O6 Molecular Weight (g/mol): 178.95 MDL Number: MFCD00149788 InChI Key: MIVBAHRSNUNMPP-UHFFFAOYSA-N Synonym: manganese ii nitrate hydrate,acmc-1brrd,manganese nitrate hydrate,mn.2no3.h2o,manganese 2+ ion hydrate dinitrate,manganese 2+ hydrate dinitrate,manganese ii nitrate hydrate, puratronic,manganese 2+ nitrate-water 1/2/1 PubChem CID: 16211480 SMILES: [Mn++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 16211480 |
|---|---|
| CAS | 15710-66-4 |
| Molecular Weight (g/mol) | 178.95 |
| MDL Number | MFCD00149788 |
| SMILES | [Mn++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | manganese ii nitrate hydrate,acmc-1brrd,manganese nitrate hydrate,mn.2no3.h2o,manganese 2+ ion hydrate dinitrate,manganese 2+ hydrate dinitrate,manganese ii nitrate hydrate, puratronic,manganese 2+ nitrate-water 1/2/1 |
| InChI Key | MIVBAHRSNUNMPP-UHFFFAOYSA-N |
| Molecular Formula | MnN2O6 |